C9H8N2O3S — CID 54340665
N-(1,2-oxazol-4-yl)benzenesulfonamide (PubChem CID 54340665) has the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. Its IUPAC name is N-(1,2-oxazol-4-yl)benzenesulfonamide.
| Compound Name | N-(1,2-oxazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 54340665 |
| Molecular Formula | C9H8N2O3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | N-(1,2-oxazol-4-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cnoc1)c1ccccc1 |
| InChI | InChI=1S/C9H8N2O3S/c12-15(13,9-4-2-1-3-5-9)11-8-6-10-14-7-8/h1-7,11H |
| InChIKey | TYSDXKKHWGUBTC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |