C11H12N2O4S — CID 62915619
3-(1-hydroxyethyl)-N-(1,2-oxazol-4-yl)benzenesulfonamide (PubChem CID 62915619) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)-N-(1,2-oxazol-4-yl)benzenesulfonamide.
| Compound Name | 3-(1-hydroxyethyl)-N-(1,2-oxazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 62915619 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-(1-hydroxyethyl)-N-(1,2-oxazol-4-yl)benzenesulfonamide |
| SMILES | CC(O)c1cccc(S(=O)(=O)Nc2cnoc2)c1 |
| InChI | InChI=1S/C11H12N2O4S/c1-8(14)9-3-2-4-11(5-9)18(15,16)13-10-6-12-17-7-10/h2-8,13-14H,1H3 |
| InChIKey | BYUBCOUEEUMCFN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |