C13H10N2O3S2 — CID 150217087
N-(1,2-oxazol-4-yl)-3-phenylthiophene-2-sulfonamide (PubChem CID 150217087) has the molecular formula C13H10N2O3S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-(1,2-oxazol-4-yl)-3-phenylthiophene-2-sulfonamide.
| Compound Name | N-(1,2-oxazol-4-yl)-3-phenylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 150217087 |
| Molecular Formula | C13H10N2O3S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | N-(1,2-oxazol-4-yl)-3-phenylthiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cnoc1)c1sccc1-c1ccccc1 |
| InChI | InChI=1S/C13H10N2O3S2/c16-20(17,15-11-8-14-18-9-11)13-12(6-7-19-13)10-4-2-1-3-5-10/h1-9,15H |
| InChIKey | FSRTXUOISDHMAI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |