C9H10N4O3S — CID 55130880
2-(methylamino)-N-(1,2-oxazol-4-yl)pyridine-3-sulfonamide (PubChem CID 55130880) has the molecular formula C9H10N4O3S and a molecular weight of 254.27 g/mol. Its IUPAC name is 2-(methylamino)-N-(1,2-oxazol-4-yl)pyridine-3-sulfonamide.
| Compound Name | 2-(methylamino)-N-(1,2-oxazol-4-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 55130880 |
| Molecular Formula | C9H10N4O3S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-(methylamino)-N-(1,2-oxazol-4-yl)pyridine-3-sulfonamide |
| SMILES | CNc1ncccc1S(=O)(=O)Nc1cnoc1 |
| InChI | InChI=1S/C9H10N4O3S/c1-10-9-8(3-2-4-11-9)17(14,15)13-7-5-12-16-6-7/h2-6,13H,1H3,(H,10,11) |
| InChIKey | WAQVHMZPHXYBPW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |