C11H14N4O3S — CID 62915805
N-(1,2-oxazol-4-yl)-2-(propylamino)pyridine-3-sulfonamide (PubChem CID 62915805) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is N-(1,2-oxazol-4-yl)-2-(propylamino)pyridine-3-sulfonamide.
| Compound Name | N-(1,2-oxazol-4-yl)-2-(propylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62915805 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-(1,2-oxazol-4-yl)-2-(propylamino)pyridine-3-sulfonamide |
| SMILES | CCCNc1ncccc1S(=O)(=O)Nc1cnoc1 |
| InChI | InChI=1S/C11H14N4O3S/c1-2-5-12-11-10(4-3-6-13-11)19(16,17)15-9-7-14-18-8-9/h3-4,6-8,15H,2,5H2,1H3,(H,12,13) |
| InChIKey | AXIFEFFWCDQCJF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |