C13H14BrN3O2S — CID 62149915
N-(4-bromo-3-methylphenyl)-2-(methylamino)pyridine-3-sulfonamide (PubChem CID 62149915) has the molecular formula C13H14BrN3O2S and a molecular weight of 356.25 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-(methylamino)pyridine-3-sulfonamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62149915 |
| Molecular Formula | C13H14BrN3O2S |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ncccc1S(=O)(=O)Nc1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C13H14BrN3O2S/c1-9-8-10(5-6-11(9)14)17-20(18,19)12-4-3-7-16-13(12)15-2/h3-8,17H,1-2H3,(H,15,16) |
| InChIKey | ZPINPBUGXUAKSI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |