5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid

C8H6N2O5S2 — CID 62414676

IUPAC5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid
SMILESO=C(O)c1csc(S(=O)(=O)Nc2cnoc2)c1
InChIInChI=1S/C8H6N2O5S2/c11-8(12)5-1-7(16-4-5)17(13,14)10-6-2-9-15-3-6/h1-4,10H,(H,11,12)
InChIKeyQIWLEBHGCCRQIF-UHFFFAOYSA-N
MW274.28 g/mol
LogP1.24
Rot. Bonds4

About 5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid

5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid (PubChem CID 62414676) has the molecular formula C8H6N2O5S2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid.

Molecular Properties

Compound Name5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid
PubChem CID62414676
Molecular FormulaC8H6N2O5S2
Molecular Weight274.28 g/mol
Exact Mass273.97
IUPAC Name5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid
SMILESO=C(O)c1csc(S(=O)(=O)Nc2cnoc2)c1
InChIInChI=1S/C8H6N2O5S2/c11-8(12)5-1-7(16-4-5)17(13,14)10-6-2-9-15-3-6/h1-4,10H,(H,11,12)
InChIKeyQIWLEBHGCCRQIF-UHFFFAOYSA-N
XLogP1.24
TPSA109.50 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.28
LogP ≤ 51.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid?
The IUPAC name of 5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid (CID 62414676) is 5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid.
What is the SMILES notation for 5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid?
The canonical SMILES for 5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid is O=C(O)c1csc(S(=O)(=O)Nc2cnoc2)c1.
What is the InChIKey of 5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid?
The InChIKey is QIWLEBHGCCRQIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O5S2/c11-8(12)5-1-7(16-4-5)17(13,14)10-6-2-9-15-3-6/h1-4,10H,(H,11,12).
What are the key properties of 5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid?
5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid has a molecular weight of 274.28 g/mol, XLogP of 1.24, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-oxazol-4-ylsulfamoyl)thiophene-3-carboxylic acid is sourced from PubChem (CID 62414676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).