C12H10N2O5S2 — CID 43241380
5-[(3-carbamoylphenyl)sulfamoyl]thiophene-3-carboxylic acid (PubChem CID 43241380) has the molecular formula C12H10N2O5S2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 5-[(3-carbamoylphenyl)sulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[(3-carbamoylphenyl)sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 43241380 |
| Molecular Formula | C12H10N2O5S2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 5-[(3-carbamoylphenyl)sulfamoyl]thiophene-3-carboxylic acid |
| SMILES | NC(=O)c1cccc(NS(=O)(=O)c2cc(C(=O)O)cs2)c1 |
| InChI | InChI=1S/C12H10N2O5S2/c13-11(15)7-2-1-3-9(4-7)14-21(18,19)10-5-8(6-20-10)12(16)17/h1-6,14H,(H2,13,15)(H,16,17) |
| InChIKey | UPWMQTJFQFEFAO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |