C16H17NO6S2 — CID 166239536
5-[[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]sulfamoyl]thiophene-3-carboxylic acid (PubChem CID 166239536) has the molecular formula C16H17NO6S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 5-[[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]sulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 166239536 |
| Molecular Formula | C16H17NO6S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 5-[[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]sulfamoyl]thiophene-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)c1cccc(NS(=O)(=O)c2cc(C(=O)O)cs2)c1 |
| InChI | InChI=1S/C16H17NO6S2/c1-16(2,3)23-15(20)10-5-4-6-12(7-10)17-25(21,22)13-8-11(9-24-13)14(18)19/h4-9,17H,1-3H3,(H,18,19) |
| InChIKey | HDEYLYGNRANXQD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |