C13H12FNO5S2 — CID 56797689
5-[(4-ethoxy-3-fluorophenyl)sulfamoyl]thiophene-3-carboxylic acid (PubChem CID 56797689) has the molecular formula C13H12FNO5S2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 5-[(4-ethoxy-3-fluorophenyl)sulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[(4-ethoxy-3-fluorophenyl)sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 56797689 |
| Molecular Formula | C13H12FNO5S2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 5-[(4-ethoxy-3-fluorophenyl)sulfamoyl]thiophene-3-carboxylic acid |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cc(C(=O)O)cs2)cc1F |
| InChI | InChI=1S/C13H12FNO5S2/c1-2-20-11-4-3-9(6-10(11)14)15-22(18,19)12-5-8(7-21-12)13(16)17/h3-7,15H,2H2,1H3,(H,16,17) |
| InChIKey | OHFNWEHCTYAAGT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |