C11H10N2O4S2 — CID 103798260
3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid (PubChem CID 103798260) has the molecular formula C11H10N2O4S2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid.
| Compound Name | 3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 103798260 |
| Molecular Formula | C11H10N2O4S2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid |
| SMILES | Cc1ncc(S(=O)(=O)Nc2cccc(C(=O)O)c2)s1 |
| InChI | InChI=1S/C11H10N2O4S2/c1-7-12-6-10(18-7)19(16,17)13-9-4-2-3-8(5-9)11(14)15/h2-6,13H,1H3,(H,14,15) |
| InChIKey | UDBLWWYZAANUKC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |