C13H12N2O4S2 — CID 103414082
(E)-3-[4-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]phenyl]prop-2-enoic acid (PubChem CID 103414082) has the molecular formula C13H12N2O4S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is (E)-3-[4-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103414082 |
| Molecular Formula | C13H12N2O4S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | (E)-3-[4-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]phenyl]prop-2-enoic acid |
| SMILES | Cc1ncc(S(=O)(=O)Nc2ccc(/C=C/C(=O)O)cc2)s1 |
| InChI | InChI=1S/C13H12N2O4S2/c1-9-14-8-13(20-9)21(18,19)15-11-5-2-10(3-6-11)4-7-12(16)17/h2-8,15H,1H3,(H,16,17)/b7-4+ |
| InChIKey | WDIFYLMWSHBKDL-QPJJXVBHSA-N |
| XLogP | 2.35 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|