C16H15NO5S — CID 2345488
(E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 2345488) has the molecular formula C16H15NO5S and a molecular weight of 333.37 g/mol. Its IUPAC name is (E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 2345488 |
| Molecular Formula | C16H15NO5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(/C=C/C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H15NO5S/c1-22-14-7-5-13(6-8-14)17-23(20,21)15-9-2-12(3-10-15)4-11-16(18)19/h2-11,17H,1H3,(H,18,19)/b11-4+ |
| InChIKey | UFDLWQHLUTYJMQ-NYYWCZLTSA-N |
| XLogP | 2.59 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|