C22H19NO5S — CID 2554303
(E)-3-[4-[(4-phenylmethoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 2554303) has the molecular formula C22H19NO5S and a molecular weight of 409.46 g/mol. Its IUPAC name is (E)-3-[4-[(4-phenylmethoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(4-phenylmethoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 2554303 |
| Molecular Formula | C22H19NO5S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (E)-3-[4-[(4-phenylmethoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(S(=O)(=O)Nc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H19NO5S/c24-22(25)15-8-17-6-13-21(14-7-17)29(26,27)23-19-9-11-20(12-10-19)28-16-18-4-2-1-3-5-18/h1-15,23H,16H2,(H,24,25)/b15-8+ |
| InChIKey | DXHLHYJGBKBCGK-OVCLIPMQSA-N |
| XLogP | 4.16 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|