C16H13NO4S2 — CID 56942170
3-[(5-methyl-1-benzothiophen-2-yl)sulfonylamino]benzoic acid (PubChem CID 56942170) has the molecular formula C16H13NO4S2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 3-[(5-methyl-1-benzothiophen-2-yl)sulfonylamino]benzoic acid.
| Compound Name | 3-[(5-methyl-1-benzothiophen-2-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 56942170 |
| Molecular Formula | C16H13NO4S2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 3-[(5-methyl-1-benzothiophen-2-yl)sulfonylamino]benzoic acid |
| SMILES | Cc1ccc2sc(S(=O)(=O)Nc3cccc(C(=O)O)c3)cc2c1 |
| InChI | InChI=1S/C16H13NO4S2/c1-10-5-6-14-12(7-10)9-15(22-14)23(20,21)17-13-4-2-3-11(8-13)16(18)19/h2-9,17H,1H3,(H,18,19) |
| InChIKey | ZISBZXMFLIGXFA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |