C16H13N3O4S3 — CID 66799915
3-[[5-(2-methylsulfanylpyrimidin-4-yl)thiophen-2-yl]sulfonylamino]benzoic acid (PubChem CID 66799915) has the molecular formula C16H13N3O4S3 and a molecular weight of 407.50 g/mol. Its IUPAC name is 3-[[5-(2-methylsulfanylpyrimidin-4-yl)thiophen-2-yl]sulfonylamino]benzoic acid.
| Compound Name | 3-[[5-(2-methylsulfanylpyrimidin-4-yl)thiophen-2-yl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 66799915 |
| Molecular Formula | C16H13N3O4S3 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 3-[[5-(2-methylsulfanylpyrimidin-4-yl)thiophen-2-yl]sulfonylamino]benzoic acid |
| SMILES | CSc1nccc(-c2ccc(S(=O)(=O)Nc3cccc(C(=O)O)c3)s2)n1 |
| InChI | InChI=1S/C16H13N3O4S3/c1-24-16-17-8-7-12(18-16)13-5-6-14(25-13)26(22,23)19-11-4-2-3-10(9-11)15(20)21/h2-9,19H,1H3,(H,20,21) |
| InChIKey | FJHVGXBDYVLLKH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |