C21H16N2O7S3 — CID 70326777
3-[[2-(1-benzothiophen-2-ylsulfonylamino)phenyl]sulfamoyl]-4-hydroxybenzoic acid (PubChem CID 70326777) has the molecular formula C21H16N2O7S3 and a molecular weight of 504.57 g/mol. Its IUPAC name is 3-[[2-(1-benzothiophen-2-ylsulfonylamino)phenyl]sulfamoyl]-4-hydroxybenzoic acid.
| Compound Name | 3-[[2-(1-benzothiophen-2-ylsulfonylamino)phenyl]sulfamoyl]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 70326777 |
| Molecular Formula | C21H16N2O7S3 |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.01 |
| IUPAC Name | 3-[[2-(1-benzothiophen-2-ylsulfonylamino)phenyl]sulfamoyl]-4-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(O)c(S(=O)(=O)Nc2ccccc2NS(=O)(=O)c2cc3ccccc3s2)c1 |
| InChI | InChI=1S/C21H16N2O7S3/c24-17-10-9-14(21(25)26)11-19(17)32(27,28)22-15-6-2-3-7-16(15)23-33(29,30)20-12-13-5-1-4-8-18(13)31-20/h1-12,22-24H,(H,25,26) |
| InChIKey | ZGDXIZUCOBAMQZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |