C17H13FN2O6S3 — CID 25352849
5-[[2-[(4-fluorophenyl)sulfonylamino]phenyl]sulfamoyl]thiophene-3-carboxylic acid (PubChem CID 25352849) has the molecular formula C17H13FN2O6S3 and a molecular weight of 456.50 g/mol. Its IUPAC name is 5-[[2-[(4-fluorophenyl)sulfonylamino]phenyl]sulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[[2-[(4-fluorophenyl)sulfonylamino]phenyl]sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 25352849 |
| Molecular Formula | C17H13FN2O6S3 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | 5-[[2-[(4-fluorophenyl)sulfonylamino]phenyl]sulfamoyl]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1csc(S(=O)(=O)Nc2ccccc2NS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H13FN2O6S3/c18-12-5-7-13(8-6-12)28(23,24)19-14-3-1-2-4-15(14)20-29(25,26)16-9-11(10-27-16)17(21)22/h1-10,19-20H,(H,21,22) |
| InChIKey | FODQIZKVLSTYKL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |