C18H14FN3O4S2 — CID 154859234
2-N-[2-[(4-fluorophenyl)sulfonylamino]phenyl]thiophene-2,4-dicarboxamide (PubChem CID 154859234) has the molecular formula C18H14FN3O4S2 and a molecular weight of 419.46 g/mol. Its IUPAC name is 2-N-[2-[(4-fluorophenyl)sulfonylamino]phenyl]thiophene-2,4-dicarboxamide.
| Compound Name | 2-N-[2-[(4-fluorophenyl)sulfonylamino]phenyl]thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 154859234 |
| Molecular Formula | C18H14FN3O4S2 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 2-N-[2-[(4-fluorophenyl)sulfonylamino]phenyl]thiophene-2,4-dicarboxamide |
| SMILES | NC(=O)c1csc(C(=O)Nc2ccccc2NS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H14FN3O4S2/c19-12-5-7-13(8-6-12)28(25,26)22-15-4-2-1-3-14(15)21-18(24)16-9-11(10-27-16)17(20)23/h1-10,22H,(H2,20,23)(H,21,24) |
| InChIKey | KEVDNECNGOYIQC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |