C20H14F3N3O4S — CID 56573065
2,4-difluoro-5-[[4-[(2-fluorophenyl)sulfamoyl]benzoyl]amino]benzamide (PubChem CID 56573065) has the molecular formula C20H14F3N3O4S and a molecular weight of 449.41 g/mol. Its IUPAC name is 2,4-difluoro-5-[[4-[(2-fluorophenyl)sulfamoyl]benzoyl]amino]benzamide.
| Compound Name | 2,4-difluoro-5-[[4-[(2-fluorophenyl)sulfamoyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 56573065 |
| Molecular Formula | C20H14F3N3O4S |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 2,4-difluoro-5-[[4-[(2-fluorophenyl)sulfamoyl]benzoyl]amino]benzamide |
| SMILES | NC(=O)c1cc(NC(=O)c2ccc(S(=O)(=O)Nc3ccccc3F)cc2)c(F)cc1F |
| InChI | InChI=1S/C20H14F3N3O4S/c21-14-3-1-2-4-17(14)26-31(29,30)12-7-5-11(6-8-12)20(28)25-18-9-13(19(24)27)15(22)10-16(18)23/h1-10,26H,(H2,24,27)(H,25,28) |
| InChIKey | WCJSHFRCOBLMLM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |