C19H19F2N3O4S — CID 56570757
5-[[3-(cyclopentylsulfamoyl)benzoyl]amino]-2,4-difluorobenzamide (PubChem CID 56570757) has the molecular formula C19H19F2N3O4S and a molecular weight of 423.44 g/mol. Its IUPAC name is 5-[[3-(cyclopentylsulfamoyl)benzoyl]amino]-2,4-difluorobenzamide.
| Compound Name | 5-[[3-(cyclopentylsulfamoyl)benzoyl]amino]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 56570757 |
| Molecular Formula | C19H19F2N3O4S |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 5-[[3-(cyclopentylsulfamoyl)benzoyl]amino]-2,4-difluorobenzamide |
| SMILES | NC(=O)c1cc(NC(=O)c2cccc(S(=O)(=O)NC3CCCC3)c2)c(F)cc1F |
| InChI | InChI=1S/C19H19F2N3O4S/c20-15-10-16(21)17(9-14(15)18(22)25)23-19(26)11-4-3-7-13(8-11)29(27,28)24-12-5-1-2-6-12/h3-4,7-10,12,24H,1-2,5-6H2,(H2,22,25)(H,23,26) |
| InChIKey | BMIZKFBBFHHYRH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |