C21H25N3O4S — CID 46465029
4-[[3-(cyclopentylsulfamoyl)benzoyl]amino]-N,3-dimethylbenzamide (PubChem CID 46465029) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 4-[[3-(cyclopentylsulfamoyl)benzoyl]amino]-N,3-dimethylbenzamide.
| Compound Name | 4-[[3-(cyclopentylsulfamoyl)benzoyl]amino]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 46465029 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 4-[[3-(cyclopentylsulfamoyl)benzoyl]amino]-N,3-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)c2cccc(S(=O)(=O)NC3CCCC3)c2)c(C)c1 |
| InChI | InChI=1S/C21H25N3O4S/c1-14-12-16(20(25)22-2)10-11-19(14)23-21(26)15-6-5-9-18(13-15)29(27,28)24-17-7-3-4-8-17/h5-6,9-13,17,24H,3-4,7-8H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | OJIFBWVPUIGNEG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |