C18H18ClFN2O3S — CID 18892580
4-chloro-N-[4-(cyclopentylsulfamoyl)-2-fluorophenyl]benzamide (PubChem CID 18892580) has the molecular formula C18H18ClFN2O3S and a molecular weight of 396.87 g/mol. Its IUPAC name is 4-chloro-N-[4-(cyclopentylsulfamoyl)-2-fluorophenyl]benzamide.
| Compound Name | 4-chloro-N-[4-(cyclopentylsulfamoyl)-2-fluorophenyl]benzamide |
|---|---|
| PubChem CID | 18892580 |
| Molecular Formula | C18H18ClFN2O3S |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 4-chloro-N-[4-(cyclopentylsulfamoyl)-2-fluorophenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NC2CCCC2)cc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClFN2O3S/c19-13-7-5-12(6-8-13)18(23)21-17-10-9-15(11-16(17)20)26(24,25)22-14-3-1-2-4-14/h5-11,14,22H,1-4H2,(H,21,23) |
| InChIKey | OFDOPXRASOHYRL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |