C20H21BrF2N2O3S — CID 25046549
N-(4-bromo-2-fluorophenyl)-5-(cycloheptylsulfamoyl)-2-fluorobenzamide (PubChem CID 25046549) has the molecular formula C20H21BrF2N2O3S and a molecular weight of 487.37 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-5-(cycloheptylsulfamoyl)-2-fluorobenzamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-5-(cycloheptylsulfamoyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 25046549 |
| Molecular Formula | C20H21BrF2N2O3S |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-5-(cycloheptylsulfamoyl)-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc(Br)cc1F)c1cc(S(=O)(=O)NC2CCCCCC2)ccc1F |
| InChI | InChI=1S/C20H21BrF2N2O3S/c21-13-7-10-19(18(23)11-13)24-20(26)16-12-15(8-9-17(16)22)29(27,28)25-14-5-3-1-2-4-6-14/h7-12,14,25H,1-6H2,(H,24,26) |
| InChIKey | ZOOXRLULLAFXNU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |