C20H22ClFN2O3S — CID 3452162
N-(3-chloro-2-methylphenyl)-5-(cyclohexylsulfamoyl)-2-fluorobenzamide (PubChem CID 3452162) has the molecular formula C20H22ClFN2O3S and a molecular weight of 424.93 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-5-(cyclohexylsulfamoyl)-2-fluorobenzamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-5-(cyclohexylsulfamoyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 3452162 |
| Molecular Formula | C20H22ClFN2O3S |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-5-(cyclohexylsulfamoyl)-2-fluorobenzamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)c1cc(S(=O)(=O)NC2CCCCC2)ccc1F |
| InChI | InChI=1S/C20H22ClFN2O3S/c1-13-17(21)8-5-9-19(13)23-20(25)16-12-15(10-11-18(16)22)28(26,27)24-14-6-3-2-4-7-14/h5,8-12,14,24H,2-4,6-7H2,1H3,(H,23,25) |
| InChIKey | FMMXVNHLOAXHQA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |