C22H20ClFN2O3S — CID 15994437
N-(3-chloro-2-methylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide (PubChem CID 15994437) has the molecular formula C22H20ClFN2O3S and a molecular weight of 446.93 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 15994437 |
| Molecular Formula | C22H20ClFN2O3S |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)c1cc(S(=O)(=O)NCCc2ccccc2)ccc1F |
| InChI | InChI=1S/C22H20ClFN2O3S/c1-15-19(23)8-5-9-21(15)26-22(27)18-14-17(10-11-20(18)24)30(28,29)25-13-12-16-6-3-2-4-7-16/h2-11,14,25H,12-13H2,1H3,(H,26,27) |
| InChIKey | NOXKJTCJMSILRA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |