C22H19Cl2FN2O4S — CID 4611034
N-(5-chloro-2-methoxyphenyl)-5-[2-(4-chlorophenyl)ethylsulfamoyl]-2-fluorobenzamide (PubChem CID 4611034) has the molecular formula C22H19Cl2FN2O4S and a molecular weight of 497.38 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-5-[2-(4-chlorophenyl)ethylsulfamoyl]-2-fluorobenzamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-5-[2-(4-chlorophenyl)ethylsulfamoyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4611034 |
| Molecular Formula | C22H19Cl2FN2O4S |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-5-[2-(4-chlorophenyl)ethylsulfamoyl]-2-fluorobenzamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)c1cc(S(=O)(=O)NCCc2ccc(Cl)cc2)ccc1F |
| InChI | InChI=1S/C22H19Cl2FN2O4S/c1-31-21-9-6-16(24)12-20(21)27-22(28)18-13-17(7-8-19(18)25)32(29,30)26-11-10-14-2-4-15(23)5-3-14/h2-9,12-13,26H,10-11H2,1H3,(H,27,28) |
| InChIKey | KBXAOKUSITVIAP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |