C23H22ClFN2O3S — CID 4136787
N-(3-chloro-2-methylphenyl)-5-[ethyl-(3-methylphenyl)sulfamoyl]-2-fluorobenzamide (PubChem CID 4136787) has the molecular formula C23H22ClFN2O3S and a molecular weight of 460.96 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-5-[ethyl-(3-methylphenyl)sulfamoyl]-2-fluorobenzamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-5-[ethyl-(3-methylphenyl)sulfamoyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4136787 |
| Molecular Formula | C23H22ClFN2O3S |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-5-[ethyl-(3-methylphenyl)sulfamoyl]-2-fluorobenzamide |
| SMILES | CCN(c1cccc(C)c1)S(=O)(=O)c1ccc(F)c(C(=O)Nc2cccc(Cl)c2C)c1 |
| InChI | InChI=1S/C23H22ClFN2O3S/c1-4-27(17-8-5-7-15(2)13-17)31(29,30)18-11-12-21(25)19(14-18)23(28)26-22-10-6-9-20(24)16(22)3/h5-14H,4H2,1-3H3,(H,26,28) |
| InChIKey | UVCKFAJYPNFPPJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |