C21H16Cl4N2O3S — CID 2344205
2-chloro-5-[ethyl(phenyl)sulfamoyl]-N-(2,4,6-trichlorophenyl)benzamide (PubChem CID 2344205) has the molecular formula C21H16Cl4N2O3S and a molecular weight of 518.25 g/mol. Its IUPAC name is 2-chloro-5-[ethyl(phenyl)sulfamoyl]-N-(2,4,6-trichlorophenyl)benzamide.
| Compound Name | 2-chloro-5-[ethyl(phenyl)sulfamoyl]-N-(2,4,6-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 2344205 |
| Molecular Formula | C21H16Cl4N2O3S |
| Molecular Weight | 518.25 g/mol |
| Exact Mass | 515.96 |
| IUPAC Name | 2-chloro-5-[ethyl(phenyl)sulfamoyl]-N-(2,4,6-trichlorophenyl)benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(Cl)c(C(=O)Nc2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C21H16Cl4N2O3S/c1-2-27(14-6-4-3-5-7-14)31(29,30)15-8-9-17(23)16(12-15)21(28)26-20-18(24)10-13(22)11-19(20)25/h3-12H,2H2,1H3,(H,26,28) |
| InChIKey | WJPORTYKWCDOEN-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.25 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |