C23H25ClN4O3S — CID 4798681
2-chloro-N-(2-cyclopentylpyrazol-3-yl)-5-[ethyl(phenyl)sulfamoyl]benzamide (PubChem CID 4798681) has the molecular formula C23H25ClN4O3S and a molecular weight of 473.00 g/mol. Its IUPAC name is 2-chloro-N-(2-cyclopentylpyrazol-3-yl)-5-[ethyl(phenyl)sulfamoyl]benzamide.
| Compound Name | 2-chloro-N-(2-cyclopentylpyrazol-3-yl)-5-[ethyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 4798681 |
| Molecular Formula | C23H25ClN4O3S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 2-chloro-N-(2-cyclopentylpyrazol-3-yl)-5-[ethyl(phenyl)sulfamoyl]benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(Cl)c(C(=O)Nc2ccnn2C2CCCC2)c1 |
| InChI | InChI=1S/C23H25ClN4O3S/c1-2-27(17-8-4-3-5-9-17)32(30,31)19-12-13-21(24)20(16-19)23(29)26-22-14-15-25-28(22)18-10-6-7-11-18/h3-5,8-9,12-16,18H,2,6-7,10-11H2,1H3,(H,26,29) |
| InChIKey | RGEVWGZBXWYXMO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |