C20H19ClN2O3S2 — CID 4814342
2-chloro-5-[ethyl(phenyl)sulfamoyl]-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 4814342) has the molecular formula C20H19ClN2O3S2 and a molecular weight of 434.97 g/mol. Its IUPAC name is 2-chloro-5-[ethyl(phenyl)sulfamoyl]-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 2-chloro-5-[ethyl(phenyl)sulfamoyl]-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4814342 |
| Molecular Formula | C20H19ClN2O3S2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 2-chloro-5-[ethyl(phenyl)sulfamoyl]-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(Cl)c(C(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C20H19ClN2O3S2/c1-2-23(15-7-4-3-5-8-15)28(25,26)17-10-11-19(21)18(13-17)20(24)22-14-16-9-6-12-27-16/h3-13H,2,14H2,1H3,(H,22,24) |
| InChIKey | ZOTJRSWBUOELTC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |