C31H33ClN2O3S — CID 4285874
N-[4-(1-adamantyl)phenyl]-2-chloro-5-[ethyl(phenyl)sulfamoyl]benzamide (PubChem CID 4285874) has the molecular formula C31H33ClN2O3S and a molecular weight of 549.14 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-2-chloro-5-[ethyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-2-chloro-5-[ethyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 4285874 |
| Molecular Formula | C31H33ClN2O3S |
| Molecular Weight | 549.14 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-2-chloro-5-[ethyl(phenyl)sulfamoyl]benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(Cl)c(C(=O)Nc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)c1 |
| InChI | InChI=1S/C31H33ClN2O3S/c1-2-34(26-6-4-3-5-7-26)38(36,37)27-12-13-29(32)28(17-27)30(35)33-25-10-8-24(9-11-25)31-18-21-14-22(19-31)16-23(15-21)20-31/h3-13,17,21-23H,2,14-16,18-20H2,1H3,(H,33,35) |
| InChIKey | VGFNRGYKXUTJBO-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.14 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |