C31H33ClN2O4S — CID 126035524
N-[4-(1-adamantyl)phenyl]-2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide (PubChem CID 126035524) has the molecular formula C31H33ClN2O4S and a molecular weight of 565.14 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126035524 |
| Molecular Formula | C31H33ClN2O4S |
| Molecular Weight | 565.14 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C31H33ClN2O4S/c1-38-28-10-12-29(13-11-28)39(36,37)34(27-8-4-25(32)5-9-27)20-30(35)33-26-6-2-24(3-7-26)31-17-21-14-22(18-31)16-23(15-21)19-31/h2-13,21-23H,14-20H2,1H3,(H,33,35) |
| InChIKey | VSCHDRZZPQEFHM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.14 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |