C31H33ClN2O3S — CID 126033402
N-[4-(1-adamantyl)phenyl]-2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 126033402) has the molecular formula C31H33ClN2O3S and a molecular weight of 549.14 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126033402 |
| Molecular Formula | C31H33ClN2O3S |
| Molecular Weight | 549.14 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C31H33ClN2O3S/c1-21-2-12-29(13-3-21)38(36,37)34(28-10-6-26(32)7-11-28)20-30(35)33-27-8-4-25(5-9-27)31-17-22-14-23(18-31)16-24(15-22)19-31/h2-13,22-24H,14-20H2,1H3,(H,33,35) |
| InChIKey | HNVJVZKKGCFKBY-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.14 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |