C19H19Cl2FN2O3S — CID 4190474
5-(cyclohexylsulfamoyl)-N-(3,5-dichlorophenyl)-2-fluorobenzamide (PubChem CID 4190474) has the molecular formula C19H19Cl2FN2O3S and a molecular weight of 445.34 g/mol. Its IUPAC name is 5-(cyclohexylsulfamoyl)-N-(3,5-dichlorophenyl)-2-fluorobenzamide.
| Compound Name | 5-(cyclohexylsulfamoyl)-N-(3,5-dichlorophenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 4190474 |
| Molecular Formula | C19H19Cl2FN2O3S |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 5-(cyclohexylsulfamoyl)-N-(3,5-dichlorophenyl)-2-fluorobenzamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)c1cc(S(=O)(=O)NC2CCCCC2)ccc1F |
| InChI | InChI=1S/C19H19Cl2FN2O3S/c20-12-8-13(21)10-15(9-12)23-19(25)17-11-16(6-7-18(17)22)28(26,27)24-14-4-2-1-3-5-14/h6-11,14,24H,1-5H2,(H,23,25) |
| InChIKey | IORFFBAEUHZISE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |