C20H23FN2O3S — CID 4643786
5-(cyclopentylsulfamoyl)-N-(3,4-dimethylphenyl)-2-fluorobenzamide (PubChem CID 4643786) has the molecular formula C20H23FN2O3S and a molecular weight of 390.48 g/mol. Its IUPAC name is 5-(cyclopentylsulfamoyl)-N-(3,4-dimethylphenyl)-2-fluorobenzamide.
| Compound Name | 5-(cyclopentylsulfamoyl)-N-(3,4-dimethylphenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 4643786 |
| Molecular Formula | C20H23FN2O3S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 5-(cyclopentylsulfamoyl)-N-(3,4-dimethylphenyl)-2-fluorobenzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(S(=O)(=O)NC3CCCC3)ccc2F)cc1C |
| InChI | InChI=1S/C20H23FN2O3S/c1-13-7-8-16(11-14(13)2)22-20(24)18-12-17(9-10-19(18)21)27(25,26)23-15-5-3-4-6-15/h7-12,15,23H,3-6H2,1-2H3,(H,22,24) |
| InChIKey | LFQVCVXEZBSFTH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |