C20H21F3N2O3S — CID 90269965
5-[[(1R)-1-cyclopentylethyl]sulfamoyl]-N-(3,4-difluorophenyl)-2-fluorobenzamide (PubChem CID 90269965) has the molecular formula C20H21F3N2O3S and a molecular weight of 426.46 g/mol. Its IUPAC name is 5-[[(1R)-1-cyclopentylethyl]sulfamoyl]-N-(3,4-difluorophenyl)-2-fluorobenzamide.
| Compound Name | 5-[[(1R)-1-cyclopentylethyl]sulfamoyl]-N-(3,4-difluorophenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 90269965 |
| Molecular Formula | C20H21F3N2O3S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 5-[[(1R)-1-cyclopentylethyl]sulfamoyl]-N-(3,4-difluorophenyl)-2-fluorobenzamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(F)c(F)c2)c1)C1CCCC1 |
| InChI | InChI=1S/C20H21F3N2O3S/c1-12(13-4-2-3-5-13)25-29(27,28)15-7-9-17(21)16(11-15)20(26)24-14-6-8-18(22)19(23)10-14/h6-13,25H,2-5H2,1H3,(H,24,26)/t12-/m1/s1 |
| InChIKey | YODRDPZWSOMUIP-GFCCVEGCSA-N |
| XLogP | 4.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |