C19H22F2N2O4S — CID 118677106
N-(3,4-difluorophenyl)-2-methoxy-5-(3-methylbutan-2-ylsulfamoyl)benzamide (PubChem CID 118677106) has the molecular formula C19H22F2N2O4S and a molecular weight of 412.46 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-methoxy-5-(3-methylbutan-2-ylsulfamoyl)benzamide.
| Compound Name | N-(3,4-difluorophenyl)-2-methoxy-5-(3-methylbutan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 118677106 |
| Molecular Formula | C19H22F2N2O4S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-methoxy-5-(3-methylbutan-2-ylsulfamoyl)benzamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)C(C)C)cc1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H22F2N2O4S/c1-11(2)12(3)23-28(25,26)14-6-8-18(27-4)15(10-14)19(24)22-13-5-7-16(20)17(21)9-13/h5-12,23H,1-4H3,(H,22,24) |
| InChIKey | CHFHYSOCSCYANN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |