C21H16F3NO2 — CID 46949187
N-(3,4-difluorophenyl)-5-[(4-fluorophenyl)methyl]-2-methoxybenzamide (PubChem CID 46949187) has the molecular formula C21H16F3NO2 and a molecular weight of 371.36 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-5-[(4-fluorophenyl)methyl]-2-methoxybenzamide.
| Compound Name | N-(3,4-difluorophenyl)-5-[(4-fluorophenyl)methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 46949187 |
| Molecular Formula | C21H16F3NO2 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-5-[(4-fluorophenyl)methyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cc2ccc(F)cc2)cc1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H16F3NO2/c1-27-20-9-4-14(10-13-2-5-15(22)6-3-13)11-17(20)21(26)25-16-7-8-18(23)19(24)12-16/h2-9,11-12H,10H2,1H3,(H,25,26) |
| InChIKey | HEICNTINEZMEAK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |