C19H13Cl2FN2O3S — CID 30879902
4-chloro-N-(2-chlorophenyl)-3-[(4-fluorophenyl)sulfonylamino]benzamide (PubChem CID 30879902) has the molecular formula C19H13Cl2FN2O3S and a molecular weight of 439.30 g/mol. Its IUPAC name is 4-chloro-N-(2-chlorophenyl)-3-[(4-fluorophenyl)sulfonylamino]benzamide.
| Compound Name | 4-chloro-N-(2-chlorophenyl)-3-[(4-fluorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 30879902 |
| Molecular Formula | C19H13Cl2FN2O3S |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 4-chloro-N-(2-chlorophenyl)-3-[(4-fluorophenyl)sulfonylamino]benzamide |
| SMILES | O=C(Nc1ccccc1Cl)c1ccc(Cl)c(NS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H13Cl2FN2O3S/c20-15-3-1-2-4-17(15)23-19(25)12-5-10-16(21)18(11-12)24-28(26,27)14-8-6-13(22)7-9-14/h1-11,24H,(H,23,25) |
| InChIKey | LDSCVQBBXRFSCH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |