C21H17ClF2N2O3S — CID 27773510
4-chloro-N-[(1S)-1-(4-fluorophenyl)ethyl]-3-[(4-fluorophenyl)sulfonylamino]benzamide (PubChem CID 27773510) has the molecular formula C21H17ClF2N2O3S and a molecular weight of 450.89 g/mol. Its IUPAC name is 4-chloro-N-[(1S)-1-(4-fluorophenyl)ethyl]-3-[(4-fluorophenyl)sulfonylamino]benzamide.
| Compound Name | 4-chloro-N-[(1S)-1-(4-fluorophenyl)ethyl]-3-[(4-fluorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 27773510 |
| Molecular Formula | C21H17ClF2N2O3S |
| Molecular Weight | 450.89 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 4-chloro-N-[(1S)-1-(4-fluorophenyl)ethyl]-3-[(4-fluorophenyl)sulfonylamino]benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(Cl)c(NS(=O)(=O)c2ccc(F)cc2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H17ClF2N2O3S/c1-13(14-2-5-16(23)6-3-14)25-21(27)15-4-11-19(22)20(12-15)26-30(28,29)18-9-7-17(24)8-10-18/h2-13,26H,1H3,(H,25,27)/t13-/m0/s1 |
| InChIKey | STQPLKQPOWVWCC-ZDUSSCGKSA-N |
| XLogP | 4.91 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.89 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |