C19H15ClFN3O5S — CID 24536134
N-[2-chloro-5-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]phenyl]-4-fluorobenzenesulfonamide (PubChem CID 24536134) has the molecular formula C19H15ClFN3O5S and a molecular weight of 451.86 g/mol. Its IUPAC name is N-[2-chloro-5-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]phenyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]phenyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 24536134 |
| Molecular Formula | C19H15ClFN3O5S |
| Molecular Weight | 451.86 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | N-[2-chloro-5-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]phenyl]-4-fluorobenzenesulfonamide |
| SMILES | Cc1occc1C(=O)NNC(=O)c1ccc(Cl)c(NS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H15ClFN3O5S/c1-11-15(8-9-29-11)19(26)23-22-18(25)12-2-7-16(20)17(10-12)24-30(27,28)14-5-3-13(21)4-6-14/h2-10,24H,1H3,(H,22,25)(H,23,26) |
| InChIKey | FITVGHSJKTVELD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.86 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|