C14H13FN4O4 — CID 51113394
1-[(4-fluorobenzoyl)amino]-3-[(2-methylfuran-3-carbonyl)amino]urea (PubChem CID 51113394) has the molecular formula C14H13FN4O4 and a molecular weight of 320.28 g/mol. Its IUPAC name is 1-[(4-fluorobenzoyl)amino]-3-[(2-methylfuran-3-carbonyl)amino]urea.
| Compound Name | 1-[(4-fluorobenzoyl)amino]-3-[(2-methylfuran-3-carbonyl)amino]urea |
|---|---|
| PubChem CID | 51113394 |
| Molecular Formula | C14H13FN4O4 |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-[(4-fluorobenzoyl)amino]-3-[(2-methylfuran-3-carbonyl)amino]urea |
| SMILES | Cc1occc1C(=O)NNC(=O)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H13FN4O4/c1-8-11(6-7-23-8)13(21)17-19-14(22)18-16-12(20)9-2-4-10(15)5-3-9/h2-7H,1H3,(H,16,20)(H,17,21)(H2,18,19,22) |
| InChIKey | UYUSQIKEDOIBAE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|