C16H13FN4O3S — CID 27172663
3-(4-fluorophenyl)-N'-(2-methylfuran-3-carbonyl)-2-sulfanylidene-1H-imidazole-4-carbohydrazide (PubChem CID 27172663) has the molecular formula C16H13FN4O3S and a molecular weight of 360.37 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N'-(2-methylfuran-3-carbonyl)-2-sulfanylidene-1H-imidazole-4-carbohydrazide.
| Compound Name | 3-(4-fluorophenyl)-N'-(2-methylfuran-3-carbonyl)-2-sulfanylidene-1H-imidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 27172663 |
| Molecular Formula | C16H13FN4O3S |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 3-(4-fluorophenyl)-N'-(2-methylfuran-3-carbonyl)-2-sulfanylidene-1H-imidazole-4-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNC(=O)c1c[nH]c(=S)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FN4O3S/c1-9-12(6-7-24-9)14(22)19-20-15(23)13-8-18-16(25)21(13)11-4-2-10(17)3-5-11/h2-8H,1H3,(H,18,25)(H,19,22)(H,20,23) |
| InChIKey | HUXOWHOVPMEJNI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|