C21H23FN4O3S2 — CID 24549148
N-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carboxamide (PubChem CID 24549148) has the molecular formula C21H23FN4O3S2 and a molecular weight of 462.57 g/mol. Its IUPAC name is N-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carboxamide.
| Compound Name | N-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 24549148 |
| Molecular Formula | C21H23FN4O3S2 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | N-[[4-(diethylsulfamoyl)phenyl]methyl]-3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)c2c[nH]c(=S)n2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H23FN4O3S2/c1-3-25(4-2)31(28,29)18-11-5-15(6-12-18)13-23-20(27)19-14-24-21(30)26(19)17-9-7-16(22)8-10-17/h5-12,14H,3-4,13H2,1-2H3,(H,23,27)(H,24,30) |
| InChIKey | PGDHZGFFVOGRLA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|