C22H23FN4O3S2 — CID 17499581
[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-[3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazol-4-yl]methanone (PubChem CID 17499581) has the molecular formula C22H23FN4O3S2 and a molecular weight of 474.58 g/mol. Its IUPAC name is [4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-[3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazol-4-yl]methanone.
| Compound Name | [4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-[3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazol-4-yl]methanone |
|---|---|
| PubChem CID | 17499581 |
| Molecular Formula | C22H23FN4O3S2 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-[3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazol-4-yl]methanone |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(C(=O)c3c[nH]c(=S)n3-c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C22H23FN4O3S2/c1-15-3-4-16(2)20(13-15)32(29,30)26-11-9-25(10-12-26)21(28)19-14-24-22(31)27(19)18-7-5-17(23)6-8-18/h3-8,13-14H,9-12H2,1-2H3,(H,24,31) |
| InChIKey | DDBRRJVKWXQYBT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|