C21H26FN5O2S — CID 30543453
2-[4-[3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carbonyl]piperazin-1-yl]-1-piperidin-1-ylethanone (PubChem CID 30543453) has the molecular formula C21H26FN5O2S and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-[4-[3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carbonyl]piperazin-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-[3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carbonyl]piperazin-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 30543453 |
| Molecular Formula | C21H26FN5O2S |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-[4-[3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carbonyl]piperazin-1-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(CN1CCN(C(=O)c2c[nH]c(=S)n2-c2ccc(F)cc2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C21H26FN5O2S/c22-16-4-6-17(7-5-16)27-18(14-23-21(27)30)20(29)26-12-10-24(11-13-26)15-19(28)25-8-2-1-3-9-25/h4-7,14H,1-3,8-13,15H2,(H,23,30) |
| InChIKey | LOJQLVWJGHOIOM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|