C23H31FN4O3 — CID 167772223
3-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazine-1-carbonyl]-1-(4-fluorophenyl)pyrrolidin-2-one (PubChem CID 167772223) has the molecular formula C23H31FN4O3 and a molecular weight of 430.52 g/mol. Its IUPAC name is 3-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazine-1-carbonyl]-1-(4-fluorophenyl)pyrrolidin-2-one.
| Compound Name | 3-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazine-1-carbonyl]-1-(4-fluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 167772223 |
| Molecular Formula | C23H31FN4O3 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 3-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazine-1-carbonyl]-1-(4-fluorophenyl)pyrrolidin-2-one |
| SMILES | O=C(CN1CCN(C(=O)C2CCN(c3ccc(F)cc3)C2=O)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C23H31FN4O3/c24-18-5-7-19(8-6-18)28-12-9-20(23(28)31)22(30)27-15-13-25(14-16-27)17-21(29)26-10-3-1-2-4-11-26/h5-8,20H,1-4,9-17H2 |
| InChIKey | ZJTDXSCAEBSLOO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|