C22H24N4O3S2 — CID 17485339
[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone (PubChem CID 17485339) has the molecular formula C22H24N4O3S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is [4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone.
| Compound Name | [4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone |
|---|---|
| PubChem CID | 17485339 |
| Molecular Formula | C22H24N4O3S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | [4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)c3c[nH]c(=S)n3-c3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C22H24N4O3S2/c1-16-8-9-19(14-17(16)2)31(28,29)25-12-10-24(11-13-25)21(27)20-15-23-22(30)26(20)18-6-4-3-5-7-18/h3-9,14-15H,10-13H2,1-2H3,(H,23,30) |
| InChIKey | VCPBWVRVOKFFQY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|