C22H22ClN3O3S — CID 55666498
(1-chloroisoquinolin-3-yl)-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 55666498) has the molecular formula C22H22ClN3O3S and a molecular weight of 443.96 g/mol. Its IUPAC name is (1-chloroisoquinolin-3-yl)-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (1-chloroisoquinolin-3-yl)-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55666498 |
| Molecular Formula | C22H22ClN3O3S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | (1-chloroisoquinolin-3-yl)-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)c3cc4ccccc4c(Cl)n3)CC2)cc1C |
| InChI | InChI=1S/C22H22ClN3O3S/c1-15-7-8-18(13-16(15)2)30(28,29)26-11-9-25(10-12-26)22(27)20-14-17-5-3-4-6-19(17)21(23)24-20/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | SNKWZLRIMGSSIQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|